C32H40F3N3O3 — CID 175049896
tert-butyl 3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]piperidine-1-carboxylate (PubChem CID 175049896) has the molecular formula C32H40F3N3O3 and a molecular weight of 571.68 g/mol. Its IUPAC name is tert-butyl 3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175049896 |
| Molecular Formula | C32H40F3N3O3 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | tert-butyl 3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]piperidine-1-carboxylate |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OC3CCCN(C(=O)OC(C)(C)C)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C32H40F3N3O3/c1-19-14-23-22-11-7-8-12-26(22)36-28(23)29(38(19)18-32(5,6)35)27-24(33)15-21(16-25(27)34)40-20-10-9-13-37(17-20)30(39)41-31(2,3)4/h7-8,11-12,15-16,19-20,29,36H,9-10,13-14,17-18H2,1-6H3/t19-,20?,29-/m1/s1 |
| InChIKey | QEVDXFBKBNKHRQ-NCPUNKGMSA-N |
| XLogP | 7.31 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|