C26H32F2N4O2S — CID 170950874
tert-butyl 3-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazol-5-yl]methyl]azetidine-1-carboxylate (PubChem CID 170950874) has the molecular formula C26H32F2N4O2S and a molecular weight of 502.63 g/mol. Its IUPAC name is tert-butyl 3-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazol-5-yl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazol-5-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 170950874 |
| Molecular Formula | C26H32F2N4O2S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | tert-butyl 3-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazol-5-yl]methyl]azetidine-1-carboxylate |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ncc(CC3CN(C(=O)OC(C)(C)C)C3)s2)N1CC(F)F |
| InChI | InChI=1S/C26H32F2N4O2S/c1-15-9-19-18-7-5-6-8-20(18)30-22(19)23(32(15)14-21(27)28)24-29-11-17(35-24)10-16-12-31(13-16)25(33)34-26(2,3)4/h5-8,11,15-16,21,23,30H,9-10,12-14H2,1-4H3/t15-,23+/m1/s1 |
| InChIKey | TUJDBBVSVDZIEJ-CMJOXMDJSA-N |
| XLogP | 5.63 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|