C27H33F2N3O5 — CID 138693389
2-[4-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]butoxy]acetic acid (PubChem CID 138693389) has the molecular formula C27H33F2N3O5 and a molecular weight of 517.57 g/mol. Its IUPAC name is 2-[4-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]butoxy]acetic acid.
| Compound Name | 2-[4-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]butoxy]acetic acid |
|---|---|
| PubChem CID | 138693389 |
| Molecular Formula | C27H33F2N3O5 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 2-[4-[2-[[6-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethoxy]butoxy]acetic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OCCOCCCCOCC(=O)O)cn2)N1CC(F)F |
| InChI | InChI=1S/C27H33F2N3O5/c1-18-14-21-20-6-2-3-7-22(20)31-26(21)27(32(18)16-24(28)29)23-9-8-19(15-30-23)37-13-12-35-10-4-5-11-36-17-25(33)34/h2-3,6-9,15,18,24,27,31H,4-5,10-14,16-17H2,1H3,(H,33,34)/t18-,27-/m1/s1 |
| InChIKey | WQAHAMQPFXYYNC-DNOBIOAJSA-N |
| XLogP | 4.44 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|