C29H34F4N2O5 — CID 138726880
2-[2-[5-[4-[(1R)-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]pentoxy]ethoxy]acetic acid (PubChem CID 138726880) has the molecular formula C29H34F4N2O5 and a molecular weight of 566.59 g/mol. Its IUPAC name is 2-[2-[5-[4-[(1R)-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]pentoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-[4-[(1R)-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]pentoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 138726880 |
| Molecular Formula | C29H34F4N2O5 |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 2-[2-[5-[4-[(1R)-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]pentoxy]ethoxy]acetic acid |
| SMILES | CC(F)(F)CN1CCc2c([nH]c3ccccc23)[C@H]1c1c(F)cc(OCCCCCOCCOCC(=O)O)cc1F |
| InChI | InChI=1S/C29H34F4N2O5/c1-29(32,33)18-35-10-9-21-20-7-3-4-8-24(20)34-27(21)28(35)26-22(30)15-19(16-23(26)31)40-12-6-2-5-11-38-13-14-39-17-25(36)37/h3-4,7-8,15-16,28,34H,2,5-6,9-14,17-18H2,1H3,(H,36,37)/t28-/m1/s1 |
| InChIKey | JVFRMIRRUPQSSB-MUUNZHRXSA-N |
| XLogP | 5.72 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|