C23H22F4N2 — CID 135230834
1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 135230834) has the molecular formula C23H22F4N2 and a molecular weight of 402.44 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 135230834 |
| Molecular Formula | C23H22F4N2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C/C=C/c1cc(F)c(C2c3[nH]c4ccccc4c3CCN2CC(C)(F)F)c(F)c1 |
| InChI | InChI=1S/C23H22F4N2/c1-3-6-14-11-17(24)20(18(25)12-14)22-21-16(9-10-29(22)13-23(2,26)27)15-7-4-5-8-19(15)28-21/h3-8,11-12,22,28H,9-10,13H2,1-2H3/b6-3+ |
| InChIKey | UNBYZLHZGXNYLX-ZZXKWVIFSA-N |
| XLogP | 6.08 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|