C26H27F3N2O2 — CID 154057094
3-[3,5-difluoro-4-[(1R)-2-(2-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 154057094) has the molecular formula C26H27F3N2O2 and a molecular weight of 456.51 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(1R)-2-(2-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-difluoro-4-[(1R)-2-(2-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154057094 |
| Molecular Formula | C26H27F3N2O2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-[3,5-difluoro-4-[(1R)-2-(2-fluoro-2-methylpropyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(F)CN1[C@H](c2c(F)cc(C=CC(=O)O)cc2F)c2[nH]c3ccccc3c2CC1(C)C |
| InChI | InChI=1S/C26H27F3N2O2/c1-25(2,29)14-31-24(22-18(27)11-15(12-19(22)28)9-10-21(32)33)23-17(13-26(31,3)4)16-7-5-6-8-20(16)30-23/h5-12,24,30H,13-14H2,1-4H3,(H,32,33)/t24-/m1/s1 |
| InChIKey | AKZLESYLLLKGNZ-XMMPIXPASA-N |
| XLogP | 6.02 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|