C24H22F2N2O2 — CID 138643377
(E)-3-[4-[(1S)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 138643377) has the molecular formula C24H22F2N2O2 and a molecular weight of 408.45 g/mol. Its IUPAC name is (E)-3-[4-[(1S)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1S)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138643377 |
| Molecular Formula | C24H22F2N2O2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (E)-3-[4-[(1S)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | C=C(CC)N1CCc2c([nH]c3ccccc23)[C@@H]1c1c(F)cc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C24H22F2N2O2/c1-3-14(2)28-11-10-17-16-6-4-5-7-20(16)27-23(17)24(28)22-18(25)12-15(13-19(22)26)8-9-21(29)30/h4-9,12-13,24,27H,2-3,10-11H2,1H3,(H,29,30)/b9-8+/t24-/m0/s1 |
| InChIKey | ZYZBBPPAZZZRAU-KDLSMAQYSA-N |
| XLogP | 5.42 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|