C24H24F2N2O3 — CID 166696295
(E)-3-[3,5-difluoro-4-[2-(2-hydroxy-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 166696295) has the molecular formula C24H24F2N2O3 and a molecular weight of 426.46 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[2-(2-hydroxy-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[2-(2-hydroxy-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166696295 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[2-(2-hydroxy-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(O)CN1CCc2c([nH]c3ccccc23)C1c1c(F)cc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C24H24F2N2O3/c1-24(2,31)13-28-10-9-16-15-5-3-4-6-19(15)27-22(16)23(28)21-17(25)11-14(12-18(21)26)7-8-20(29)30/h3-8,11-12,23,27,31H,9-10,13H2,1-2H3,(H,29,30)/b8-7+ |
| InChIKey | IEGHEDOJLDYYFL-BQYQJAHWSA-N |
| XLogP | 4.26 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|