C24H22F2N2O3 — CID 138643385
(E)-3-[3,5-difluoro-4-[(1R)-2-[(3R)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 138643385) has the molecular formula C24H22F2N2O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[(1R)-2-[(3R)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[(1R)-2-[(3R)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138643385 |
| Molecular Formula | C24H22F2N2O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[(1R)-2-[(3R)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)c([C@@H]2c3[nH]c4ccccc4c3CCN2[C@@H]2CCOC2)c(F)c1 |
| InChI | InChI=1S/C24H22F2N2O3/c25-18-11-14(5-6-21(29)30)12-19(26)22(18)24-23-17(16-3-1-2-4-20(16)27-23)7-9-28(24)15-8-10-31-13-15/h1-6,11-12,15,24,27H,7-10,13H2,(H,29,30)/b6-5+/t15-,24-/m1/s1 |
| InChIKey | IGUKRJJILXNDRA-SGVTXHBWSA-N |
| XLogP | 4.28 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|