C25H22F2N2O4 — CID 131965308
3-[3,5-difluoro-4-[(3S)-3-formyl-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 131965308) has the molecular formula C25H22F2N2O4 and a molecular weight of 452.46 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(3S)-3-formyl-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-difluoro-4-[(3S)-3-formyl-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 131965308 |
| Molecular Formula | C25H22F2N2O4 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-[3,5-difluoro-4-[(3S)-3-formyl-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C[C@@H]1Cc2c([nH]c3ccccc23)C(c2c(F)cc(C=CC(=O)O)cc2F)N1C1CCOC1 |
| InChI | InChI=1S/C25H22F2N2O4/c26-19-9-14(5-6-22(31)32)10-20(27)23(19)25-24-18(17-3-1-2-4-21(17)28-24)11-16(12-30)29(25)15-7-8-33-13-15/h1-6,9-10,12,15-16,25,28H,7-8,11,13H2,(H,31,32)/t15?,16-,25?/m0/s1 |
| InChIKey | QFGLKZSEIYHSON-BUAFLGJXSA-N |
| XLogP | 3.85 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|