C24H24F2N2O — CID 131980215
1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 131980215) has the molecular formula C24H24F2N2O and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 131980215 |
| Molecular Formula | C24H24F2N2O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[2,6-difluoro-4-[(E)-prop-1-enyl]phenyl]-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C/C=C/c1cc(F)c(C2c3[nH]c4ccccc4c3CCN2C2CCOC2)c(F)c1 |
| InChI | InChI=1S/C24H24F2N2O/c1-2-5-15-12-19(25)22(20(26)13-15)24-23-18(17-6-3-4-7-21(17)27-23)8-10-28(24)16-9-11-29-14-16/h2-7,12-13,16,24,27H,8-11,14H2,1H3/b5-2+ |
| InChIKey | HQPMLPQFXZMIJP-GORDUTHDSA-N |
| XLogP | 5.22 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|