C21H18F4N2O2 — CID 164924257
methyl 4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorobenzoate (PubChem CID 164924257) has the molecular formula C21H18F4N2O2 and a molecular weight of 406.38 g/mol. Its IUPAC name is methyl 4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorobenzoate.
| Compound Name | methyl 4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 164924257 |
| Molecular Formula | C21H18F4N2O2 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | methyl 4-[2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(C2c3[nH]c4ccccc4c3CCN2CC(F)F)c(F)c1 |
| InChI | InChI=1S/C21H18F4N2O2/c1-29-21(28)11-8-14(22)18(15(23)9-11)20-19-13(6-7-27(20)10-17(24)25)12-4-2-3-5-16(12)26-19/h2-5,8-9,17,20,26H,6-7,10H2,1H3 |
| InChIKey | DHZVYITZSSRZIM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|