C26H30F3N3O3 — CID 121427712
(2R)-3-[(1R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propane-1,2-diol (PubChem CID 121427712) has the molecular formula C26H30F3N3O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is (2R)-3-[(1R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propane-1,2-diol.
| Compound Name | (2R)-3-[(1R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 121427712 |
| Molecular Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (2R)-3-[(1R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propane-1,2-diol |
| SMILES | OC[C@H](O)CN1CCc2c([nH]c3ccccc23)[C@H]1c1c(F)cc(OCCN2CC(CF)C2)cc1F |
| InChI | InChI=1S/C26H30F3N3O3/c27-11-16-12-31(13-16)7-8-35-18-9-21(28)24(22(29)10-18)26-25-20(5-6-32(26)14-17(34)15-33)19-3-1-2-4-23(19)30-25/h1-4,9-10,16-17,26,30,33-34H,5-8,11-15H2/t17-,26-/m1/s1 |
| InChIKey | VOBFIMGUCKTBDA-WGDIFIGCSA-N |
| XLogP | 3.03 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|