C25H28F3N3OS — CID 166844130
1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-methylsulfanyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole (PubChem CID 166844130) has the molecular formula C25H28F3N3OS and a molecular weight of 475.58 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-methylsulfanyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole.
| Compound Name | 1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-methylsulfanyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole |
|---|---|
| PubChem CID | 166844130 |
| Molecular Formula | C25H28F3N3OS |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2-methylsulfanyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole |
| SMILES | CSN1CCCc2c([nH]c3ccccc23)C1c1c(F)cc(OCCN2CC(CF)C2)cc1F |
| InChI | InChI=1S/C25H28F3N3OS/c1-33-31-8-4-6-19-18-5-2-3-7-22(18)29-24(19)25(31)23-20(27)11-17(12-21(23)28)32-10-9-30-14-16(13-26)15-30/h2-3,5,7,11-12,16,25,29H,4,6,8-10,13-15H2,1H3 |
| InChIKey | UEEBFJLPTBQXPX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|