C25H28F5N3O — CID 145450317
N-[2-[4-[2-(2,3-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine (PubChem CID 145450317) has the molecular formula C25H28F5N3O and a molecular weight of 481.51 g/mol. Its IUPAC name is N-[2-[4-[2-(2,3-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine.
| Compound Name | N-[2-[4-[2-(2,3-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 145450317 |
| Molecular Formula | C25H28F5N3O |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[2-[4-[2-(2,3-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine |
| SMILES | FCCCNCCOc1cc(F)c(C2c3[nH]c4ccccc4c3CCN2CC(F)CF)c(F)c1 |
| InChI | InChI=1S/C25H28F5N3O/c26-7-3-8-31-9-11-34-17-12-20(29)23(21(30)13-17)25-24-19(6-10-33(25)15-16(28)14-27)18-4-1-2-5-22(18)32-24/h1-2,4-5,12-13,16,25,31-32H,3,6-11,14-15H2 |
| InChIKey | OXBGOYIPZRZGQP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|