C23H26F4N4O — CID 155032418
3-fluoro-N-[2-[[6-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine (PubChem CID 155032418) has the molecular formula C23H26F4N4O and a molecular weight of 450.48 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[6-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[[6-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 155032418 |
| Molecular Formula | C23H26F4N4O |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 3-fluoro-N-[2-[[6-[2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine |
| SMILES | FCCCNCCOc1cccc(C2c3[nH]c4ccccc4c3CCN2CC(F)(F)F)n1 |
| InChI | InChI=1S/C23H26F4N4O/c24-10-4-11-28-12-14-32-20-8-3-7-19(29-20)22-21-17(9-13-31(22)15-23(25,26)27)16-5-1-2-6-18(16)30-21/h1-3,5-8,22,28,30H,4,9-15H2 |
| InChIKey | DDDNNHALDJVLDM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|