C26H30F5N3O — CID 142405363
3-fluoro-N-[2-[2-fluoro-4-methyl-3-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine (PubChem CID 142405363) has the molecular formula C26H30F5N3O and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-fluoro-N-[2-[2-fluoro-4-methyl-3-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[2-fluoro-4-methyl-3-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 142405363 |
| Molecular Formula | C26H30F5N3O |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-fluoro-N-[2-[2-fluoro-4-methyl-3-[(3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine |
| SMILES | Cc1ccc(OCCNCCCF)c(F)c1C1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C26H30F5N3O/c1-16-8-9-21(35-13-12-32-11-5-10-27)23(28)22(16)25-24-19(18-6-3-4-7-20(18)33-24)14-17(2)34(25)15-26(29,30)31/h3-4,6-9,17,25,32-33H,5,10-15H2,1-2H3/t17-,25?/m1/s1 |
| InChIKey | VDHHNYKYQYVKKQ-SMFUYQKNSA-N |
| XLogP | 5.84 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|