C27H32Cl2FN3O3 — CID 135277067
(2S)-3-[(1R,3R)-1-[2,6-dichloro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid (PubChem CID 135277067) has the molecular formula C27H32Cl2FN3O3 and a molecular weight of 536.48 g/mol. Its IUPAC name is (2S)-3-[(1R,3R)-1-[2,6-dichloro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1R,3R)-1-[2,6-dichloro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135277067 |
| Molecular Formula | C27H32Cl2FN3O3 |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (2S)-3-[(1R,3R)-1-[2,6-dichloro-3-[2-(3-fluoropropylamino)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(Cl)ccc(OCCNCCCF)c2Cl)N1C[C@H](C)C(=O)O |
| InChI | InChI=1S/C27H32Cl2FN3O3/c1-16(27(34)35)15-33-17(2)14-19-18-6-3-4-7-21(18)32-25(19)26(33)23-20(28)8-9-22(24(23)29)36-13-12-31-11-5-10-30/h3-4,6-9,16-17,26,31-32H,5,10-15H2,1-2H3,(H,34,35)/t16-,17+,26+/m0/s1 |
| InChIKey | BVXHNEYXSTUIFZ-PAPQREIWSA-N |
| XLogP | 5.86 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|