C25H32F3N5O — CID 134199690
N'-[5-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxy-2-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine (PubChem CID 134199690) has the molecular formula C25H32F3N5O and a molecular weight of 475.56 g/mol. Its IUPAC name is N'-[5-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxy-2-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine.
| Compound Name | N'-[5-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxy-2-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 134199690 |
| Molecular Formula | C25H32F3N5O |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N'-[5-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxy-2-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNCCCF)ncc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)F |
| InChI | InChI=1S/C25H32F3N5O/c1-16-12-18-17-6-3-4-7-20(17)32-24(18)25(33(16)15-22(27)28)19-14-31-23(13-21(19)34-2)30-11-10-29-9-5-8-26/h3-4,6-7,13-14,16,22,25,29,32H,5,8-12,15H2,1-2H3,(H,30,31)/t16-,25-/m1/s1 |
| InChIKey | LMGXBNSNQWLKCY-PUAOIOHZSA-N |
| XLogP | 4.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|