C27H30F6N4O — CID 164855410
4-[2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-3-(trifluoromethoxy)aniline (PubChem CID 164855410) has the molecular formula C27H30F6N4O and a molecular weight of 540.55 g/mol. Its IUPAC name is 4-[2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-3-(trifluoromethoxy)aniline.
| Compound Name | 4-[2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-3-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 164855410 |
| Molecular Formula | C27H30F6N4O |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 4-[2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-3-(trifluoromethoxy)aniline |
| SMILES | CC1Cc2c([nH]c3ccccc23)C(c2ccc(NCCN3CC(CF)C3)cc2OC(F)(F)F)N1CC(F)F |
| InChI | InChI=1S/C27H30F6N4O/c1-16-10-21-19-4-2-3-5-22(19)35-25(21)26(37(16)15-24(29)30)20-7-6-18(11-23(20)38-27(31,32)33)34-8-9-36-13-17(12-28)14-36/h2-7,11,16-17,24,26,34-35H,8-10,12-15H2,1H3 |
| InChIKey | ILMFNOFRVOJPST-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|