C25H29F3N4O2S — CID 154987736
[3-fluoro-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethylamino]-2-[(1R,3R)-3-methyl-2-methylsulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] hypofluorite (PubChem CID 154987736) has the molecular formula C25H29F3N4O2S and a molecular weight of 506.59 g/mol. Its IUPAC name is [3-fluoro-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethylamino]-2-[(1R,3R)-3-methyl-2-methylsulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] hypofluorite.
| Compound Name | [3-fluoro-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethylamino]-2-[(1R,3R)-3-methyl-2-methylsulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] hypofluorite |
|---|---|
| PubChem CID | 154987736 |
| Molecular Formula | C25H29F3N4O2S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [3-fluoro-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethylamino]-2-[(1R,3R)-3-methyl-2-methylsulfinyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl] hypofluorite |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NCCN3CC(CF)C3)cc2OF)N1S(C)=O |
| InChI | InChI=1S/C25H29F3N4O2S/c1-15-9-19-18-5-3-4-6-21(18)30-24(19)25(32(15)35(2)33)23-20(27)10-17(11-22(23)34-28)29-7-8-31-13-16(12-26)14-31/h3-6,10-11,15-16,25,29-30H,7-9,12-14H2,1-2H3/t15-,25-,35?/m1/s1 |
| InChIKey | QVXBWOWNXROFNN-NIOMTKKKSA-N |
| XLogP | 4.51 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|