C24H28F4N4O — CID 135277080
N-[2-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluoro-4-pyridinyl]oxy]ethyl]-3-fluoropropan-1-amine (PubChem CID 135277080) has the molecular formula C24H28F4N4O and a molecular weight of 464.51 g/mol. Its IUPAC name is N-[2-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluoro-4-pyridinyl]oxy]ethyl]-3-fluoropropan-1-amine.
| Compound Name | N-[2-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluoro-4-pyridinyl]oxy]ethyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 135277080 |
| Molecular Formula | C24H28F4N4O |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-[2-[[2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluoro-4-pyridinyl]oxy]ethyl]-3-fluoropropan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2nccc(OCCNCCCF)c2F)N1CC(F)F |
| InChI | InChI=1S/C24H28F4N4O/c1-15-13-17-16-5-2-3-6-18(16)31-22(17)24(32(15)14-20(26)27)23-21(28)19(7-10-30-23)33-12-11-29-9-4-8-25/h2-3,5-7,10,15,20,24,29,31H,4,8-9,11-14H2,1H3/t15-,24+/m1/s1 |
| InChIKey | CENZPFDOVSYKKI-MYYSRTQBSA-N |
| XLogP | 4.63 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|