C26H29F6N3O — CID 146208771
N-[2-[3-[(1R)-3,3-dimethyl-2-(2,2,2-trifluoroethyl)-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-2,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine (PubChem CID 146208771) has the molecular formula C26H29F6N3O and a molecular weight of 513.53 g/mol. Its IUPAC name is N-[2-[3-[(1R)-3,3-dimethyl-2-(2,2,2-trifluoroethyl)-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-2,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine.
| Compound Name | N-[2-[3-[(1R)-3,3-dimethyl-2-(2,2,2-trifluoroethyl)-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-2,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 146208771 |
| Molecular Formula | C26H29F6N3O |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | N-[2-[3-[(1R)-3,3-dimethyl-2-(2,2,2-trifluoroethyl)-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-2,5-difluorophenoxy]ethyl]-3-fluoropropan-1-amine |
| SMILES | CC1(C)Cc2c([nH]c3ccccc23)[C@@H](c2cc(F)cc(OCCNCCCF)c2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H29F6N3O/c1-25(2)14-19-17-6-3-4-7-20(17)34-23(19)24(35(25)15-26(30,31)32)18-12-16(28)13-21(22(18)29)36-11-10-33-9-5-8-27/h3-4,6-7,12-13,24,33-34H,5,8-11,14-15H2,1-2H3/t24-/m1/s1 |
| InChIKey | DEHOLMMEMGJMRA-XMMPIXPASA-N |
| XLogP | 6.06 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|