C26H30F5N3O3 — CID 135277059
2,2-difluoro-3-[(1R)-6-fluoro-1-[2-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-6-methoxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol (PubChem CID 135277059) has the molecular formula C26H30F5N3O3 and a molecular weight of 527.53 g/mol. Its IUPAC name is 2,2-difluoro-3-[(1R)-6-fluoro-1-[2-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-6-methoxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[(1R)-6-fluoro-1-[2-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-6-methoxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 135277059 |
| Molecular Formula | C26H30F5N3O3 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2,2-difluoro-3-[(1R)-6-fluoro-1-[2-fluoro-3-[2-(3-fluoropropylamino)ethoxy]-6-methoxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
| SMILES | COc1ccc(OCCNCCCF)c(F)c1[C@@H]1c2[nH]c3ccc(F)cc3c2CCN1CC(F)(F)CO |
| InChI | InChI=1S/C26H30F5N3O3/c1-36-20-5-6-21(37-12-10-32-9-2-8-27)23(29)22(20)25-24-17(7-11-34(25)14-26(30,31)15-35)18-13-16(28)3-4-19(18)33-24/h3-6,13,25,32-33,35H,2,7-12,14-15H2,1H3/t25-/m1/s1 |
| InChIKey | JFKDOFUAOHBDJB-RUZDIDTESA-N |
| XLogP | 4.36 |
| TPSA | 69.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|