C28H33F4N3O3 — CID 135277042
methyl (2R)-3-[1-[3-[2-(3,3-difluoropropylamino)ethoxy]-6-fluoro-2-methylphenyl]-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate (PubChem CID 135277042) has the molecular formula C28H33F4N3O3 and a molecular weight of 535.58 g/mol. Its IUPAC name is methyl (2R)-3-[1-[3-[2-(3,3-difluoropropylamino)ethoxy]-6-fluoro-2-methylphenyl]-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate.
| Compound Name | methyl (2R)-3-[1-[3-[2-(3,3-difluoropropylamino)ethoxy]-6-fluoro-2-methylphenyl]-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 135277042 |
| Molecular Formula | C28H33F4N3O3 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | methyl (2R)-3-[1-[3-[2-(3,3-difluoropropylamino)ethoxy]-6-fluoro-2-methylphenyl]-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)CN1CCc2c([nH]c3ccc(F)cc23)C1c1c(F)ccc(OCCNCCC(F)F)c1C |
| InChI | InChI=1S/C28H33F4N3O3/c1-16(28(36)37-3)15-35-12-9-19-20-14-18(29)4-6-22(20)34-26(19)27(35)25-17(2)23(7-5-21(25)30)38-13-11-33-10-8-24(31)32/h4-7,14,16,24,27,33-34H,8-13,15H2,1-3H3/t16-,27?/m1/s1 |
| InChIKey | IBJDUACNDBJMSV-DKEDTHNGSA-N |
| XLogP | 5.13 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|