C14H15FN2O2 — CID 113090109
ethyl 6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 113090109) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is ethyl 6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl 6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 113090109 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | ethyl 6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c([nH]c3ccc(F)cc23)C1 |
| InChI | InChI=1S/C14H15FN2O2/c1-2-19-14(18)17-6-5-10-11-7-9(15)3-4-12(11)16-13(10)8-17/h3-4,7,16H,2,5-6,8H2,1H3 |
| InChIKey | ZEMQADDYMUSLAE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|