C14H17FN2 — CID 71425514
2-ethyl-7-fluoro-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole (PubChem CID 71425514) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole.
| Compound Name | 2-ethyl-7-fluoro-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole |
|---|---|
| PubChem CID | 71425514 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-ethyl-7-fluoro-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole |
| SMILES | CCN1CCCc2c([nH]c3ccc(F)cc23)C1 |
| InChI | InChI=1S/C14H17FN2/c1-2-17-7-3-4-11-12-8-10(15)5-6-13(12)16-14(11)9-17/h5-6,8,16H,2-4,7,9H2,1H3 |
| InChIKey | XQRXNLBIPDNMCB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|