C14H14F4N2 — CID 154987678
(3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 154987678) has the molecular formula C14H14F4N2 and a molecular weight of 286.27 g/mol. Its IUPAC name is (3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 154987678 |
| Molecular Formula | C14H14F4N2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (3R)-6-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccc(F)cc23)CN1CC(F)(F)F |
| InChI | InChI=1S/C14H14F4N2/c1-8-4-10-11-5-9(15)2-3-12(11)19-13(10)6-20(8)7-14(16,17)18/h2-3,5,8,19H,4,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | ZCLUTTIHXBHCJR-MRVPVSSYSA-N |
| XLogP | 3.62 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|