C29H35F5N4 — CID 164924005
9-(3,5-difluorophenyl)-2,9-diazaspiro[4.6]undecane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164924005) has the molecular formula C29H35F5N4 and a molecular weight of 534.62 g/mol. Its IUPAC name is 9-(3,5-difluorophenyl)-2,9-diazaspiro[4.6]undecane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-(3,5-difluorophenyl)-2,9-diazaspiro[4.6]undecane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164924005 |
| Molecular Formula | C29H35F5N4 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 9-(3,5-difluorophenyl)-2,9-diazaspiro[4.6]undecane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(F)(F)F.Fc1cc(F)cc(N2CCCC3(CCNC3)CC2)c1 |
| InChI | InChI=1S/C15H20F2N2.C14H15F3N2/c16-12-8-13(17)10-14(9-12)19-6-1-2-15(4-7-19)3-5-18-11-15;1-9-6-11-10-4-2-3-5-12(10)18-13(11)7-19(9)8-14(15,16)17/h8-10,18H,1-7,11H2;2-5,9,18H,6-8H2,1H3 |
| InChIKey | IHRJXBCNHIZROB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|