C24H27F5N2O — CID 145102279
1,3-difluoro-5-propoxybenzene;(3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 145102279) has the molecular formula C24H27F5N2O and a molecular weight of 454.48 g/mol. Its IUPAC name is 1,3-difluoro-5-propoxybenzene;(3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1,3-difluoro-5-propoxybenzene;(3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 145102279 |
| Molecular Formula | C24H27F5N2O |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1,3-difluoro-5-propoxybenzene;(3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCOc1cc(F)cc(F)c1.Cc1ccc2[nH]c3c(c2c1)C[C@@H](C)N(CC(F)(F)F)C3 |
| InChI | InChI=1S/C15H17F3N2.C9H10F2O/c1-9-3-4-13-11(5-9)12-6-10(2)20(7-14(12)19-13)8-15(16,17)18;1-2-3-12-9-5-7(10)4-8(11)6-9/h3-5,10,19H,6-8H2,1-2H3;4-6H,2-3H2,1H3/t10-;/m1./s1 |
| InChIKey | CEIRUDZQOSZYNG-HNCPQSOCSA-N |
| XLogP | 6.54 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|