C29H39F2N3O — CID 145102228
3-(3,5-difluorophenoxy)-1-propylazetidine;2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 145102228) has the molecular formula C29H39F2N3O and a molecular weight of 483.65 g/mol. Its IUPAC name is 3-(3,5-difluorophenoxy)-1-propylazetidine;2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 3-(3,5-difluorophenoxy)-1-propylazetidine;2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 145102228 |
| Molecular Formula | C29H39F2N3O |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 3-(3,5-difluorophenoxy)-1-propylazetidine;2-(2,2-dimethylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(C)(C)C.CCCN1CC(Oc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C17H24N2.C12H15F2NO/c1-12-9-14-13-7-5-6-8-15(13)18-16(14)10-19(12)11-17(2,3)4;1-2-3-15-7-12(8-15)16-11-5-9(13)4-10(14)6-11/h5-8,12,18H,9-11H2,1-4H3;4-6,12H,2-3,7-8H2,1H3 |
| InChIKey | FIZKCYAVIZNFAJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|