C28H38F3N3O — CID 145102226
1-[2-(3,5-difluorophenoxy)ethyl]-3-(fluoromethyl)azetidine;ethane;(3R)-2-ethyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 145102226) has the molecular formula C28H38F3N3O and a molecular weight of 489.63 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-3-(fluoromethyl)azetidine;ethane;(3R)-2-ethyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-3-(fluoromethyl)azetidine;ethane;(3R)-2-ethyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 145102226 |
| Molecular Formula | C28H38F3N3O |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-3-(fluoromethyl)azetidine;ethane;(3R)-2-ethyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC.CCN1Cc2[nH]c3ccccc3c2C[C@H]1C.FCC1CN(CCOc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C14H18N2.C12H14F3NO.C2H6/c1-3-16-9-14-12(8-10(16)2)11-6-4-5-7-13(11)15-14;13-6-9-7-16(8-9)1-2-17-12-4-10(14)3-11(15)5-12;1-2/h4-7,10,15H,3,8-9H2,1-2H3;3-5,9H,1-2,6-8H2;1-2H3/t10-;;/m1../s1 |
| InChIKey | IEFGRVFHBWFIBI-YQFADDPSSA-N |
| XLogP | 6.21 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|