C30H31F3N4O2 — CID 155475474
4-[(1R,3R)-1-[1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]ethenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-oxobutanenitrile (PubChem CID 155475474) has the molecular formula C30H31F3N4O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is 4-[(1R,3R)-1-[1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]ethenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-oxobutanenitrile.
| Compound Name | 4-[(1R,3R)-1-[1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]ethenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-oxobutanenitrile |
|---|---|
| PubChem CID | 155475474 |
| Molecular Formula | C30H31F3N4O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 4-[(1R,3R)-1-[1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]ethenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-oxobutanenitrile |
| SMILES | C=C(c1c(F)cc(OCCN2CC(CF)C2)cc1F)[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1C(=O)CCC#N |
| InChI | InChI=1S/C30H31F3N4O2/c1-18-12-23-22-6-3-4-7-26(22)35-29(23)30(37(18)27(38)8-5-9-34)19(2)28-24(32)13-21(14-25(28)33)39-11-10-36-16-20(15-31)17-36/h3-4,6-7,13-14,18,20,30,35H,2,5,8,10-12,15-17H2,1H3/t18-,30-/m1/s1 |
| InChIKey | KWXXYXOVFYVROM-VPTFNQTCSA-N |
| XLogP | 5.56 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|