C14H17F2N3 — CID 174310707
1,1-difluoro-2-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanamine (PubChem CID 174310707) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1,1-difluoro-2-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanamine.
| Compound Name | 1,1-difluoro-2-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanamine |
|---|---|
| PubChem CID | 174310707 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1,1-difluoro-2-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanamine |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(N)(F)F |
| InChI | InChI=1S/C14H17F2N3/c1-9-6-11-10-4-2-3-5-12(10)18-13(11)7-19(9)8-14(15,16)17/h2-5,9,18H,6-8,17H2,1H3 |
| InChIKey | YYPDYVDXBFAOBY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|