C28H34F2N4O — CID 170951190
2,2-difluoro-3-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-ol;2-[(3-methylazetidin-1-yl)methyl]-1H-indole (PubChem CID 170951190) has the molecular formula C28H34F2N4O and a molecular weight of 480.60 g/mol. Its IUPAC name is 2,2-difluoro-3-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-ol;2-[(3-methylazetidin-1-yl)methyl]-1H-indole.
| Compound Name | 2,2-difluoro-3-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-ol;2-[(3-methylazetidin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 170951190 |
| Molecular Formula | C28H34F2N4O |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2,2-difluoro-3-(3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-ol;2-[(3-methylazetidin-1-yl)methyl]-1H-indole |
| SMILES | CC1CN(Cc2cc3ccccc3[nH]2)C1.CC1Cc2c([nH]c3ccccc23)CN1CC(F)(F)CO |
| InChI | InChI=1S/C15H18F2N2O.C13H16N2/c1-10-6-12-11-4-2-3-5-13(11)18-14(12)7-19(10)8-15(16,17)9-20;1-10-7-15(8-10)9-12-6-11-4-2-3-5-13(11)14-12/h2-5,10,18,20H,6-9H2,1H3;2-6,10,14H,7-9H2,1H3 |
| InChIKey | VBGQIBUVDJJLGQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|