C27H33F5N4 — CID 164923628
2-(3,5-difluorophenyl)-2,6-diazaspiro[3.3]heptane;ethane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164923628) has the molecular formula C27H33F5N4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-2,6-diazaspiro[3.3]heptane;ethane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(3,5-difluorophenyl)-2,6-diazaspiro[3.3]heptane;ethane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164923628 |
| Molecular Formula | C27H33F5N4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-(3,5-difluorophenyl)-2,6-diazaspiro[3.3]heptane;ethane;3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC.CC1Cc2c([nH]c3ccccc23)CN1CC(F)(F)F.Fc1cc(F)cc(N2CC3(CNC3)C2)c1 |
| InChI | InChI=1S/C14H15F3N2.C11H12F2N2.C2H6/c1-9-6-11-10-4-2-3-5-12(10)18-13(11)7-19(9)8-14(15,16)17;12-8-1-9(13)3-10(2-8)15-6-11(7-15)4-14-5-11;1-2/h2-5,9,18H,6-8H2,1H3;1-3,14H,4-7H2;1-2H3 |
| InChIKey | DXMULERGXWCUOJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|