C32H42F4N4 — CID 164923113
3-(3,5-difluorophenyl)-3,10-diazaspiro[5.7]tridecane;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164923113) has the molecular formula C32H42F4N4 and a molecular weight of 558.71 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-3,10-diazaspiro[5.7]tridecane;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 3-(3,5-difluorophenyl)-3,10-diazaspiro[5.7]tridecane;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164923113 |
| Molecular Formula | C32H42F4N4 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 3-(3,5-difluorophenyl)-3,10-diazaspiro[5.7]tridecane;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(C)(F)F.Fc1cc(F)cc(N2CCC3(CCCNCCC3)CC2)c1 |
| InChI | InChI=1S/C17H24F2N2.C15H18F2N2/c18-14-11-15(19)13-16(12-14)21-9-5-17(6-10-21)3-1-7-20-8-2-4-17;1-10-7-12-11-5-3-4-6-13(11)18-14(12)8-19(10)9-15(2,16)17/h11-13,20H,1-10H2;3-6,10,18H,7-9H2,1-2H3 |
| InChIKey | ONFQTEZGDFTXBC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|