C30H36F4N4O2 — CID 164923310
2-[2-(3,5-difluorophenyl)-2,7-diazaspiro[4.4]nonan-7-yl]acetic acid;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164923310) has the molecular formula C30H36F4N4O2 and a molecular weight of 560.64 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)-2,7-diazaspiro[4.4]nonan-7-yl]acetic acid;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[2-(3,5-difluorophenyl)-2,7-diazaspiro[4.4]nonan-7-yl]acetic acid;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164923310 |
| Molecular Formula | C30H36F4N4O2 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)-2,7-diazaspiro[4.4]nonan-7-yl]acetic acid;2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(C)(F)F.O=C(O)CN1CCC2(CCN(c3cc(F)cc(F)c3)C2)C1 |
| InChI | InChI=1S/C15H18F2N2O2.C15H18F2N2/c16-11-5-12(17)7-13(6-11)19-4-2-15(10-19)1-3-18(9-15)8-14(20)21;1-10-7-12-11-5-3-4-6-13(11)18-14(12)8-19(10)9-15(2,16)17/h5-7H,1-4,8-10H2,(H,20,21);3-6,10,18H,7-9H2,1-2H3 |
| InChIKey | PKAMXBHKHMQVLN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|