C30H39F3N4 — CID 164923601
8-(3,5-difluorophenyl)-2,8-diazaspiro[4.5]decane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164923601) has the molecular formula C30H39F3N4 and a molecular weight of 512.66 g/mol. Its IUPAC name is 8-(3,5-difluorophenyl)-2,8-diazaspiro[4.5]decane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 8-(3,5-difluorophenyl)-2,8-diazaspiro[4.5]decane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164923601 |
| Molecular Formula | C30H39F3N4 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 8-(3,5-difluorophenyl)-2,8-diazaspiro[4.5]decane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(C)(C)F.Fc1cc(F)cc(N2CCC3(CCNC3)CC2)c1 |
| InChI | InChI=1S/C16H21FN2.C14H18F2N2/c1-11-8-13-12-6-4-5-7-14(12)18-15(13)9-19(11)10-16(2,3)17;15-11-7-12(16)9-13(8-11)18-5-2-14(3-6-18)1-4-17-10-14/h4-7,11,18H,8-10H2,1-3H3;7-9,17H,1-6,10H2 |
| InChIKey | RTIKYZZPRBSXPU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|