C28H35F3N4 — CID 164923426
2-(3,5-difluorophenyl)-2,7-diazaspiro[3.4]octane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164923426) has the molecular formula C28H35F3N4 and a molecular weight of 484.61 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-2,7-diazaspiro[3.4]octane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(3,5-difluorophenyl)-2,7-diazaspiro[3.4]octane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164923426 |
| Molecular Formula | C28H35F3N4 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-(3,5-difluorophenyl)-2,7-diazaspiro[3.4]octane;2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccccc23)CN1CC(C)(C)F.Fc1cc(F)cc(N2CC3(CCNC3)C2)c1 |
| InChI | InChI=1S/C16H21FN2.C12H14F2N2/c1-11-8-13-12-6-4-5-7-14(12)18-15(13)9-19(11)10-16(2,3)17;13-9-3-10(14)5-11(4-9)16-7-12(8-16)1-2-15-6-12/h4-7,11,18H,8-10H2,1-3H3;3-5,15H,1-2,6-8H2 |
| InChIKey | WTCDHNNPMUZCGB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|