C28H29F5N4 — CID 170951014
(1R,3R)-1-[2-[[3-(fluoromethyl)azetidin-1-yl]methyl]-1H-indol-5-yl]-3-methyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 170951014) has the molecular formula C28H29F5N4 and a molecular weight of 516.56 g/mol. Its IUPAC name is (1R,3R)-1-[2-[[3-(fluoromethyl)azetidin-1-yl]methyl]-1H-indol-5-yl]-3-methyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[2-[[3-(fluoromethyl)azetidin-1-yl]methyl]-1H-indol-5-yl]-3-methyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170951014 |
| Molecular Formula | C28H29F5N4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (1R,3R)-1-[2-[[3-(fluoromethyl)azetidin-1-yl]methyl]-1H-indol-5-yl]-3-methyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc3[nH]c(CN4CC(CF)C4)cc3c2)N1CC(F)(F)C(F)F |
| InChI | InChI=1S/C28H29F5N4/c1-16-8-22-21-4-2-3-5-24(21)35-25(22)26(37(16)15-28(32,33)27(30)31)18-6-7-23-19(9-18)10-20(34-23)14-36-12-17(11-29)13-36/h2-7,9-10,16-17,26-27,34-35H,8,11-15H2,1H3/t16-,26-/m1/s1 |
| InChIKey | KMCLCSYLDSVSSJ-AKJBCIBTSA-N |
| XLogP | 6.29 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|