C30H35FN4O — CID 170951197
6-[[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methyl]-2-oxa-6-azaspiro[3.3]heptane (PubChem CID 170951197) has the molecular formula C30H35FN4O and a molecular weight of 486.64 g/mol. Its IUPAC name is 6-[[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methyl]-2-oxa-6-azaspiro[3.3]heptane.
| Compound Name | 6-[[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methyl]-2-oxa-6-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 170951197 |
| Molecular Formula | C30H35FN4O |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 6-[[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methyl]-2-oxa-6-azaspiro[3.3]heptane |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc3[nH]c(CN4CC5(COC5)C4)cc3c2)N1CC(C)(C)F |
| InChI | InChI=1S/C30H35FN4O/c1-19-10-24-23-6-4-5-7-26(23)33-27(24)28(35(19)14-29(2,3)31)20-8-9-25-21(11-20)12-22(32-25)13-34-15-30(16-34)17-36-18-30/h4-9,11-12,19,28,32-33H,10,13-18H2,1-3H3/t19-,28-/m1/s1 |
| InChIKey | MNZHJCRVLIUZSH-WHLCRQNOSA-N |
| XLogP | 5.57 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|