C24H22F5N3O — CID 170951109
[5-[(1R,3R)-3-methyl-2-(2,2,3,3,3-pentafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methanol (PubChem CID 170951109) has the molecular formula C24H22F5N3O and a molecular weight of 463.45 g/mol. Its IUPAC name is [5-[(1R,3R)-3-methyl-2-(2,2,3,3,3-pentafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methanol.
| Compound Name | [5-[(1R,3R)-3-methyl-2-(2,2,3,3,3-pentafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 170951109 |
| Molecular Formula | C24H22F5N3O |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [5-[(1R,3R)-3-methyl-2-(2,2,3,3,3-pentafluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1H-indol-2-yl]methanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc3[nH]c(CO)cc3c2)N1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H22F5N3O/c1-13-8-18-17-4-2-3-5-20(17)31-21(18)22(32(13)12-23(25,26)24(27,28)29)14-6-7-19-15(9-14)10-16(11-33)30-19/h2-7,9-10,13,22,30-31,33H,8,11-12H2,1H3/t13-,22-/m1/s1 |
| InChIKey | LQPKFXQEMWQWKR-MCMMXHMISA-N |
| XLogP | 5.68 |
| TPSA | 55.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|