C19H26FN3O — CID 56730042
1-ethyl-3-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]piperidin-3-ol (PubChem CID 56730042) has the molecular formula C19H26FN3O and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-ethyl-3-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]piperidin-3-ol.
| Compound Name | 1-ethyl-3-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 56730042 |
| Molecular Formula | C19H26FN3O |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-ethyl-3-[(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]piperidin-3-ol |
| SMILES | CCN1CCCC(O)(CN2CCc3[nH]c4ccc(F)cc4c3C2)C1 |
| InChI | InChI=1S/C19H26FN3O/c1-2-22-8-3-7-19(24,12-22)13-23-9-6-18-16(11-23)15-10-14(20)4-5-17(15)21-18/h4-5,10,21,24H,2-3,6-9,11-13H2,1H3 |
| InChIKey | PFVZJFGECIWPMA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|