C21H20F2N2O2 — CID 122174311
3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propyl 4-fluorobenzoate (PubChem CID 122174311) has the molecular formula C21H20F2N2O2 and a molecular weight of 370.40 g/mol. Its IUPAC name is 3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propyl 4-fluorobenzoate.
| Compound Name | 3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 122174311 |
| Molecular Formula | C21H20F2N2O2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propyl 4-fluorobenzoate |
| SMILES | O=C(OCCCN1CCc2[nH]c3ccc(F)cc3c2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20F2N2O2/c22-15-4-2-14(3-5-15)21(26)27-11-1-9-25-10-8-20-18(13-25)17-12-16(23)6-7-19(17)24-20/h2-7,12,24H,1,8-11,13H2 |
| InChIKey | DINJEVFVEFBOHN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|