C17H23N3O2 — CID 10086232
2-(dimethylamino)ethyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 10086232) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 10086232 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | CN(C)CCOC(=O)c1ccc2[nH]c3c(c2c1)CN(C)CC3 |
| InChI | InChI=1S/C17H23N3O2/c1-19(2)8-9-22-17(21)12-4-5-15-13(10-12)14-11-20(3)7-6-16(14)18-15/h4-5,10,18H,6-9,11H2,1-3H3 |
| InChIKey | OXHLBWIJRKDFMA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|