C42H44N4O6S — CID 158314893
benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate;benzyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 158314893) has the molecular formula C42H44N4O6S and a molecular weight of 732.90 g/mol. Its IUPAC name is benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate;benzyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate;benzyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 158314893 |
| Molecular Formula | C42H44N4O6S |
| Molecular Weight | 732.90 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | benzyl 5-ethylsulfonyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate;benzyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)OCc4ccccc4)ccc31)CN(C)CC2.CN1CCc2[nH]c3ccc(C(=O)OCc4ccccc4)cc3c2C1 |
| InChI | InChI=1S/C22H24N2O4S.C20H20N2O2/c1-3-29(26,27)24-20-10-9-17(22(25)28-15-16-7-5-4-6-8-16)13-18(20)19-14-23(2)12-11-21(19)24;1-22-10-9-19-17(12-22)16-11-15(7-8-18(16)21-19)20(23)24-13-14-5-3-2-4-6-14/h4-10,13H,3,11-12,14-15H2,1-2H3;2-8,11,21H,9-10,12-13H2,1H3 |
| InChIKey | GODIOTJMZNOTFN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.90 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|