C20H18N2O4 — CID 50887965
(4-nitrophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 50887965) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 50887965 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (4-nitrophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C20H18N2O4/c23-20(26-12-13-5-8-15(9-6-13)22(24)25)14-7-10-19-17(11-14)16-3-1-2-4-18(16)21-19/h5-11,21H,1-4,12H2 |
| InChIKey | VNWZORNZFRRNCZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|