C19H18N2O3 — CID 7404422
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 7404422) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 7404422 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | O=C(OCC(=O)c1ccc[nH]1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C19H18N2O3/c22-18(17-6-3-9-20-17)11-24-19(23)12-7-8-16-14(10-12)13-4-1-2-5-15(13)21-16/h3,6-10,20-21H,1-2,4-5,11H2 |
| InChIKey | JGHJLSJEUAGSMO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|