C23H21NO5 — CID 2433964
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 2433964) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 2433964 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H21NO5/c25-20(14-6-8-21-22(12-14)28-10-9-27-21)13-29-23(26)15-5-7-19-17(11-15)16-3-1-2-4-18(16)24-19/h5-8,11-12,24H,1-4,9-10,13H2 |
| InChIKey | DHXAOKKTTLWSPH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|